year
Category: | Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
||||||||||
CAS NO: | 105-58-8 | |||||||||||
EC NO: | 203-311-1 | |||||||||||
Molecular Formula: | C5H10O3 | |||||||||||
Molecular Weight: | 118.1311 | |||||||||||
Specification: | ||||||||||||
InChI: | InChI=1/C5H10O3/c1-3-7-5(6)8-4-2/h3-4H2,1-2H3 | |||||||||||
Packing: | In galvanized iron drum of 200kgs. | |||||||||||
Product description: Diethyl Carbonate(DEC) Chemical Name: Diethyl Carbonate
? |
||||||||||||
Synonyms: | Ethyl carbonate;Carbonic acid diethyl ester;diethyl dicarbonate;Diethyl ester of carbonic acid;Diatol; | |||||||||||
Molecular Structure: |